C13H24N2S — CID 79476552
N'-methyl-N'-(1-thiophen-2-ylpropan-2-yl)pentane-1,5-diamine (PubChem CID 79476552) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is N'-methyl-N'-(1-thiophen-2-ylpropan-2-yl)pentane-1,5-diamine.
| Compound Name | N'-methyl-N'-(1-thiophen-2-ylpropan-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 79476552 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N'-methyl-N'-(1-thiophen-2-ylpropan-2-yl)pentane-1,5-diamine |
| SMILES | CC(Cc1cccs1)N(C)CCCCCN |
| InChI | InChI=1S/C13H24N2S/c1-12(11-13-7-6-10-16-13)15(2)9-5-3-4-8-14/h6-7,10,12H,3-5,8-9,11,14H2,1-2H3 |
| InChIKey | RCKLZZYLNJUSOB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|