C12H20N2S — CID 103070954
N'-methyl-2-methylidene-N'-(1-thiophen-2-ylpropan-2-yl)propane-1,3-diamine (PubChem CID 103070954) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is N'-methyl-2-methylidene-N'-(1-thiophen-2-ylpropan-2-yl)propane-1,3-diamine.
| Compound Name | N'-methyl-2-methylidene-N'-(1-thiophen-2-ylpropan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103070954 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N'-methyl-2-methylidene-N'-(1-thiophen-2-ylpropan-2-yl)propane-1,3-diamine |
| SMILES | C=C(CN)CN(C)C(C)Cc1cccs1 |
| InChI | InChI=1S/C12H20N2S/c1-10(8-13)9-14(3)11(2)7-12-5-4-6-15-12/h4-6,11H,1,7-9,13H2,2-3H3 |
| InChIKey | LSEIARZYHIPJIT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|