C16H26N2O2S — CID 79488662
N-(2-methyl-4-oxopentan-3-yl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]acetamide (PubChem CID 79488662) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is N-(2-methyl-4-oxopentan-3-yl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]acetamide.
| Compound Name | N-(2-methyl-4-oxopentan-3-yl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 79488662 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(2-methyl-4-oxopentan-3-yl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]acetamide |
| SMILES | CC(=O)C(NC(=O)CN(C)C(C)Cc1cccs1)C(C)C |
| InChI | InChI=1S/C16H26N2O2S/c1-11(2)16(13(4)19)17-15(20)10-18(5)12(3)9-14-7-6-8-21-14/h6-8,11-12,16H,9-10H2,1-5H3,(H,17,20) |
| InChIKey | MRAAGMWGIKLQTA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |