C16H18BrNOS — CID 79486106
1-(4-bromophenyl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]ethanone (PubChem CID 79486106) has the molecular formula C16H18BrNOS and a molecular weight of 352.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]ethanone |
|---|---|
| PubChem CID | 79486106 |
| Molecular Formula | C16H18BrNOS |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 1-(4-bromophenyl)-2-[methyl(1-thiophen-2-ylpropan-2-yl)amino]ethanone |
| SMILES | CC(Cc1cccs1)N(C)CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H18BrNOS/c1-12(10-15-4-3-9-20-15)18(2)11-16(19)13-5-7-14(17)8-6-13/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | FIXFTUPFQFHFPA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |