C14H20N2O2S2 — CID 97087904
2-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]amino]-N-[(3R)-2-oxothiolan-3-yl]acetamide (PubChem CID 97087904) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]amino]-N-[(3R)-2-oxothiolan-3-yl]acetamide.
| Compound Name | 2-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]amino]-N-[(3R)-2-oxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 97087904 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]amino]-N-[(3R)-2-oxothiolan-3-yl]acetamide |
| SMILES | C[C@@H](Cc1cccs1)N(C)CC(=O)N[C@@H]1CCSC1=O |
| InChI | InChI=1S/C14H20N2O2S2/c1-10(8-11-4-3-6-19-11)16(2)9-13(17)15-12-5-7-20-14(12)18/h3-4,6,10,12H,5,7-9H2,1-2H3,(H,15,17)/t10-,12+/m0/s1 |
| InChIKey | ACBFUKJPPOXMRQ-CMPLNLGQSA-N |
| XLogP | 1.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|