About S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate
S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate (PubChem CID 76968388) has the molecular formula C12H13NO3S3
and a molecular weight of 315.44 g/mol. Its IUPAC name is S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate.
Molecular Properties
| Compound Name | S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate |
| PubChem CID | 76968388 |
| Molecular Formula | C12H13NO3S3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate |
| SMILES | C[C@@H](SC(=O)c1cccs1)C(=O)N[C@@H]1CCSC1=O |
| InChI | InChI=1S/C12H13NO3S3/c1-7(19-12(16)9-3-2-5-17-9)10(14)13-8-4-6-18-11(8)15/h2-3,5,7-8H,4,6H2,1H3,(H,13,14)/t7-,8-/m1/s1 |
| InChIKey | MKTVMEMIKNBVHI-HTQZYQBOSA-N |
| XLogP | 2.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate?
The IUPAC name of S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate (CID 76968388) is S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate.
What is the SMILES notation for S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate?
The canonical SMILES for S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate is C[C@@H](SC(=O)c1cccs1)C(=O)N[C@@H]1CCSC1=O.
What is the InChIKey of S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate?
The InChIKey is MKTVMEMIKNBVHI-HTQZYQBOSA-N. The full InChI is InChI=1S/C12H13NO3S3/c1-7(19-12(16)9-3-2-5-17-9)10(14)13-8-4-6-18-11(8)15/h2-3,5,7-8H,4,6H2,1H3,(H,13,14)/t7-,8-/m1/s1.
What are the key properties of S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate?
S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate has a molecular weight of 315.44 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R)-1-oxo-1-[[(3R)-2-oxothiolan-3-yl]amino]propan-2-yl] thiophene-2-carbothioate is sourced from PubChem (CID 76968388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).