C13H20ClN3O2S — CID 119385819
N-[1-oxo-1-(piperidin-4-ylamino)propan-2-yl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119385819) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is N-[1-oxo-1-(piperidin-4-ylamino)propan-2-yl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[1-oxo-1-(piperidin-4-ylamino)propan-2-yl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119385819 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-[1-oxo-1-(piperidin-4-ylamino)propan-2-yl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CC(NC(=O)c1cccs1)C(=O)NC1CCNCC1.Cl |
| InChI | InChI=1S/C13H19N3O2S.ClH/c1-9(15-13(18)11-3-2-8-19-11)12(17)16-10-4-6-14-7-5-10;/h2-3,8-10,14H,4-7H2,1H3,(H,15,18)(H,16,17);1H |
| InChIKey | RJCWZYATMRFGAJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |