C14H22ClN3O2S — CID 119474452
N-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119474452) has the molecular formula C14H22ClN3O2S and a molecular weight of 331.87 g/mol. Its IUPAC name is N-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119474452 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CC(NC(=O)c1cccs1)C(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C14H21N3O2S.ClH/c1-9(16-14(19)12-3-2-8-20-12)13(18)17-11-6-4-10(15)5-7-11;/h2-3,8-11H,4-7,15H2,1H3,(H,16,19)(H,17,18);1H |
| InChIKey | GHCIIZYVDXPFCI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |