C12H19N3O3S2 — CID 119387925
N-piperidin-4-yl-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 119387925) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-piperidin-4-yl-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-piperidin-4-yl-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 119387925 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-piperidin-4-yl-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)NC1CCNCC1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-9(12(16)14-10-4-6-13-7-5-10)15-20(17,18)11-3-2-8-19-11/h2-3,8-10,13,15H,4-7H2,1H3,(H,14,16) |
| InChIKey | AYNXFNKHKDECNS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |