C13H13FN2O3S2 — CID 110601235
N-(2-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 110601235) has the molecular formula C13H13FN2O3S2 and a molecular weight of 328.39 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(2-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 110601235 |
| Molecular Formula | C13H13FN2O3S2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N-(2-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C13H13FN2O3S2/c1-9(16-21(18,19)12-7-4-8-20-12)13(17)15-11-6-3-2-5-10(11)14/h2-9,16H,1H3,(H,15,17) |
| InChIKey | KTHXQZZAAWFKMB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |