C10H14FN3O3S — CID 110606507
N-(2-fluorophenyl)-2-(methylsulfamoylamino)propanamide (PubChem CID 110606507) has the molecular formula C10H14FN3O3S and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(methylsulfamoylamino)propanamide.
| Compound Name | N-(2-fluorophenyl)-2-(methylsulfamoylamino)propanamide |
|---|---|
| PubChem CID | 110606507 |
| Molecular Formula | C10H14FN3O3S |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-(2-fluorophenyl)-2-(methylsulfamoylamino)propanamide |
| SMILES | CNS(=O)(=O)NC(C)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C10H14FN3O3S/c1-7(14-18(16,17)12-2)10(15)13-9-6-4-3-5-8(9)11/h3-7,12,14H,1-2H3,(H,13,15) |
| InChIKey | JDLLBJKXMDSMOE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |