C14H21FN2O5S — CID 110606513
N-(2-fluorophenyl)-2-[2-(2-methoxyethoxy)ethylsulfonylamino]propanamide (PubChem CID 110606513) has the molecular formula C14H21FN2O5S and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[2-(2-methoxyethoxy)ethylsulfonylamino]propanamide.
| Compound Name | N-(2-fluorophenyl)-2-[2-(2-methoxyethoxy)ethylsulfonylamino]propanamide |
|---|---|
| PubChem CID | 110606513 |
| Molecular Formula | C14H21FN2O5S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-(2-fluorophenyl)-2-[2-(2-methoxyethoxy)ethylsulfonylamino]propanamide |
| SMILES | COCCOCCS(=O)(=O)NC(C)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C14H21FN2O5S/c1-11(14(18)16-13-6-4-3-5-12(13)15)17-23(19,20)10-9-22-8-7-21-2/h3-6,11,17H,7-10H2,1-2H3,(H,16,18) |
| InChIKey | UFQYPIFZFHUQOO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|