C12H18FNO4S — CID 110409686
N-[(2-fluorophenyl)methyl]-2-(2-methoxyethoxy)ethanesulfonamide (PubChem CID 110409686) has the molecular formula C12H18FNO4S and a molecular weight of 291.34 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-(2-methoxyethoxy)ethanesulfonamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-(2-methoxyethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 110409686 |
| Molecular Formula | C12H18FNO4S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-(2-methoxyethoxy)ethanesulfonamide |
| SMILES | COCCOCCS(=O)(=O)NCc1ccccc1F |
| InChI | InChI=1S/C12H18FNO4S/c1-17-6-7-18-8-9-19(15,16)14-10-11-4-2-3-5-12(11)13/h2-5,14H,6-10H2,1H3 |
| InChIKey | HTUPXJSSAQMRME-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|