C11H16ClFN2O — CID 119262319
2-amino-N-(2-fluorophenyl)-3-methylbutanamide;hydrochloride (PubChem CID 119262319) has the molecular formula C11H16ClFN2O and a molecular weight of 246.71 g/mol. Its IUPAC name is 2-amino-N-(2-fluorophenyl)-3-methylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-(2-fluorophenyl)-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119262319 |
| Molecular Formula | C11H16ClFN2O |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-amino-N-(2-fluorophenyl)-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)C(N)C(=O)Nc1ccccc1F.Cl |
| InChI | InChI=1S/C11H15FN2O.ClH/c1-7(2)10(13)11(15)14-9-6-4-3-5-8(9)12;/h3-7,10H,13H2,1-2H3,(H,14,15);1H |
| InChIKey | SJNHCNUDEHLHGE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |