C16H19N3O4S2 — CID 48529738
N,2-dimethyl-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide (PubChem CID 48529738) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N,2-dimethyl-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide.
| Compound Name | N,2-dimethyl-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide |
|---|---|
| PubChem CID | 48529738 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N,2-dimethyl-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C(C)NS(=O)(=O)c2cccs2)c1C |
| InChI | InChI=1S/C16H19N3O4S2/c1-10-12(16(21)17-3)6-4-7-13(10)18-15(20)11(2)19-25(22,23)14-8-5-9-24-14/h4-9,11,19H,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | IHKDXGYWHUPDGT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |