C11H14N4O3S2 — CID 47321746
N-(1-methylpyrazol-3-yl)-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 47321746) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(1-methylpyrazol-3-yl)-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(1-methylpyrazol-3-yl)-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 47321746 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-(1-methylpyrazol-3-yl)-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C11H14N4O3S2/c1-8(11(16)12-9-5-6-15(2)13-9)14-20(17,18)10-4-3-7-19-10/h3-8,14H,1-2H3,(H,12,13,16) |
| InChIKey | KTWAXBHNLSPTTM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |