C10H12N4O3S2 — CID 95280952
(2R)-N-(1H-pyrazol-5-yl)-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 95280952) has the molecular formula C10H12N4O3S2 and a molecular weight of 300.37 g/mol. Its IUPAC name is (2R)-N-(1H-pyrazol-5-yl)-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | (2R)-N-(1H-pyrazol-5-yl)-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 95280952 |
| Molecular Formula | C10H12N4O3S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (2R)-N-(1H-pyrazol-5-yl)-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cccs1)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C10H12N4O3S2/c1-7(10(15)12-8-4-5-11-13-8)14-19(16,17)9-3-2-6-18-9/h2-7,14H,1H3,(H2,11,12,13,15)/t7-/m1/s1 |
| InChIKey | IWXLKAYKFTYBNJ-SSDOTTSWSA-N |
| XLogP | 0.78 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |