C14H20N2O5S2 — CID 119230364
4-[2-(thiophen-2-ylsulfonylamino)propanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 119230364) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-[2-(thiophen-2-ylsulfonylamino)propanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(thiophen-2-ylsulfonylamino)propanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119230364 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[2-(thiophen-2-ylsulfonylamino)propanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-9(16-23(20,21)12-3-2-8-22-12)13(17)15-11-6-4-10(5-7-11)14(18)19/h2-3,8-11,16H,4-7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | QGNLLWXGRGULMI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |