C14H20N2O6S2 — CID 120542107
4-[[2-(thiophen-2-ylsulfonylamino)propanoylamino]methyl]oxane-4-carboxylic acid (PubChem CID 120542107) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[[2-(thiophen-2-ylsulfonylamino)propanoylamino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[2-(thiophen-2-ylsulfonylamino)propanoylamino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542107 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 4-[[2-(thiophen-2-ylsulfonylamino)propanoylamino]methyl]oxane-4-carboxylic acid |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)NCC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C14H20N2O6S2/c1-10(16-24(20,21)11-3-2-8-23-11)12(17)15-9-14(13(18)19)4-6-22-7-5-14/h2-3,8,10,16H,4-7,9H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | IVIUNOKOBVMQGG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |