C19H26N4O3S2 — CID 56523305
N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 56523305) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 56523305 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)NCc1ccccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-15(21-28(25,26)18-8-5-13-27-18)19(24)20-14-16-6-3-4-7-17(16)23-11-9-22(2)10-12-23/h3-8,13,15,21H,9-12,14H2,1-2H3,(H,20,24) |
| InChIKey | ZCYFDMTXLDKABK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |