C26H31FN4O3S2 — CID 22422656
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 22422656) has the molecular formula C26H31FN4O3S2 and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 22422656 |
| Molecular Formula | C26H31FN4O3S2 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-3-phenyl-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)C(Cc1ccccc1)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C26H31FN4O3S2/c27-22-10-4-5-11-24(22)31-17-15-30(16-18-31)14-7-13-28-26(32)23(20-21-8-2-1-3-9-21)29-36(33,34)25-12-6-19-35-25/h1-6,8-12,19,23,29H,7,13-18,20H2,(H,28,32) |
| InChIKey | SFPGUBFOHJZRNL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|