C19H34N4O3S2 — CID 92712119
(2S)-3-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 92712119) has the molecular formula C19H34N4O3S2 and a molecular weight of 430.64 g/mol. Its IUPAC name is (2S)-3-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2S)-3-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 92712119 |
| Molecular Formula | C19H34N4O3S2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (2S)-3-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CCCN1CCN(CCCNC(=O)[C@@H](NS(=O)(=O)c2cccs2)C(C)C)CC1 |
| InChI | InChI=1S/C19H34N4O3S2/c1-4-9-22-11-13-23(14-12-22)10-6-8-20-19(24)18(16(2)3)21-28(25,26)17-7-5-15-27-17/h5,7,15-16,18,21H,4,6,8-14H2,1-3H3,(H,20,24)/t18-/m0/s1 |
| InChIKey | KCCSYHWOQFSEPA-SFHVURJKSA-N |
| XLogP | 1.58 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|