C19H33N3O3S2 — CID 92712117
(2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 92712117) has the molecular formula C19H33N3O3S2 and a molecular weight of 415.63 g/mol. Its IUPAC name is (2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 92712117 |
| Molecular Formula | C19H33N3O3S2 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (2R)-N-[3-[cyclohexyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1cccs1)C(=O)NCCCN(C)C1CCCCC1 |
| InChI | InChI=1S/C19H33N3O3S2/c1-15(2)18(21-27(24,25)17-11-7-14-26-17)19(23)20-12-8-13-22(3)16-9-5-4-6-10-16/h7,11,14-16,18,21H,4-6,8-10,12-13H2,1-3H3,(H,20,23)/t18-/m1/s1 |
| InChIKey | CGXZKJSYGZZSDM-GOSISDBHSA-N |
| XLogP | 2.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|