C15H26N2O4S2 — CID 41111125
(2R)-3-methyl-N-(3-propan-2-yloxypropyl)-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 41111125) has the molecular formula C15H26N2O4S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is (2R)-3-methyl-N-(3-propan-2-yloxypropyl)-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2R)-3-methyl-N-(3-propan-2-yloxypropyl)-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 41111125 |
| Molecular Formula | C15H26N2O4S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2R)-3-methyl-N-(3-propan-2-yloxypropyl)-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)OCCCNC(=O)[C@H](NS(=O)(=O)c1cccs1)C(C)C |
| InChI | InChI=1S/C15H26N2O4S2/c1-11(2)14(15(18)16-8-6-9-21-12(3)4)17-23(19,20)13-7-5-10-22-13/h5,7,10-12,14,17H,6,8-9H2,1-4H3,(H,16,18)/t14-/m1/s1 |
| InChIKey | CWVAAMLCFHCOKW-CQSZACIVSA-N |
| XLogP | 1.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|