C18H24N2O4S2 — CID 39397239
N-(3-propan-2-yloxypropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 39397239) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-(3-propan-2-yloxypropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-(3-propan-2-yloxypropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 39397239 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-(3-propan-2-yloxypropyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | CC(C)OCCCNC(=O)Cc1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-14(2)24-11-4-10-19-17(21)13-15-6-8-16(9-7-15)20-26(22,23)18-5-3-12-25-18/h3,5-9,12,14,20H,4,10-11,13H2,1-2H3,(H,19,21) |
| InChIKey | PHEBBHXTZCIZMY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|