C22H31N3O3S2 — CID 55735081
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide (PubChem CID 55735081) has the molecular formula C22H31N3O3S2 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 55735081 |
| Molecular Formula | C22H31N3O3S2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-[4-(thiophen-2-ylsulfonylamino)phenyl]acetamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)Cc2ccc(NS(=O)(=O)c3cccs3)cc2)C1 |
| InChI | InChI=1S/C22H31N3O3S2/c1-17-13-18(2)16-25(15-17)11-4-10-23-21(26)14-19-6-8-20(9-7-19)24-30(27,28)22-5-3-12-29-22/h3,5-9,12,17-18,24H,4,10-11,13-16H2,1-2H3,(H,23,26) |
| InChIKey | LFMZHQDKXRWRLX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|