C19H25N3O3S2 — CID 18150972
N-(3-piperidin-1-ylpropyl)-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 18150972) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-(3-piperidin-1-ylpropyl)-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(3-piperidin-1-ylpropyl)-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 18150972 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(3-piperidin-1-ylpropyl)-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NCCCN1CCCCC1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H25N3O3S2/c23-19(20-11-5-14-22-12-2-1-3-13-22)16-7-9-17(10-8-16)21-27(24,25)18-6-4-15-26-18/h4,6-10,15,21H,1-3,5,11-14H2,(H,20,23) |
| InChIKey | QCDAAYHAUWWTCJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|