C21H21N5O5S4 — CID 4070087
N-(3-imidazol-1-ylpropyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 4070087) has the molecular formula C21H21N5O5S4 and a molecular weight of 551.70 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 4070087 |
| Molecular Formula | C21H21N5O5S4 |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H21N5O5S4/c27-21(23-6-3-8-26-9-7-22-15-26)16-12-17(24-34(28,29)19-4-1-10-32-19)14-18(13-16)25-35(30,31)20-5-2-11-33-20/h1-2,4-5,7,9-15,24-25H,3,6,8H2,(H,23,27) |
| InChIKey | JTBHOLXTLQNFMP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|