C19H18Cl2N4O3S — CID 35513286
3-[(3,4-dichlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 35513286) has the molecular formula C19H18Cl2N4O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 35513286 |
| Molecular Formula | C19H18Cl2N4O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1cccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H18Cl2N4O3S/c20-17-6-5-16(12-18(17)21)29(27,28)24-15-4-1-3-14(11-15)19(26)23-7-2-9-25-10-8-22-13-25/h1,3-6,8,10-13,24H,2,7,9H2,(H,23,26) |
| InChIKey | AXOBIXYOYASZLU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|