C22H28Cl2N4O3S — CID 55656521
3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide (PubChem CID 55656521) has the molecular formula C22H28Cl2N4O3S and a molecular weight of 499.46 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 55656521 |
| Molecular Formula | C22H28Cl2N4O3S |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)sulfonylamino]-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide |
| SMILES | CN1CCN(CCCCNC(=O)c2cccc(NS(=O)(=O)c3ccc(Cl)c(Cl)c3)c2)CC1 |
| InChI | InChI=1S/C22H28Cl2N4O3S/c1-27-11-13-28(14-12-27)10-3-2-9-25-22(29)17-5-4-6-18(15-17)26-32(30,31)19-7-8-20(23)21(24)16-19/h4-8,15-16,26H,2-3,9-14H2,1H3,(H,25,29) |
| InChIKey | HLJPRQZSRGIMSD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|