C17H28N4O3S — CID 55660415
N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(methanesulfonamido)benzamide (PubChem CID 55660415) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 55660415 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-3-(methanesulfonamido)benzamide |
| SMILES | CCN1CCN(CCCNC(=O)c2cccc(NS(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C17H28N4O3S/c1-3-20-10-12-21(13-11-20)9-5-8-18-17(22)15-6-4-7-16(14-15)19-25(2,23)24/h4,6-7,14,19H,3,5,8-13H2,1-2H3,(H,18,22) |
| InChIKey | TYEGSBPYRNYDPF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|