C21H28N4O5S2 — CID 55428456
N-(3-methoxypropyl)-2-[4-[4-(thiophen-2-ylsulfonylamino)benzoyl]piperazin-1-yl]acetamide (PubChem CID 55428456) has the molecular formula C21H28N4O5S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[4-(thiophen-2-ylsulfonylamino)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[4-(thiophen-2-ylsulfonylamino)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55428456 |
| Molecular Formula | C21H28N4O5S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[4-(thiophen-2-ylsulfonylamino)benzoyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C21H28N4O5S2/c1-30-14-3-9-22-19(26)16-24-10-12-25(13-11-24)21(27)17-5-7-18(8-6-17)23-32(28,29)20-4-2-15-31-20/h2,4-8,15,23H,3,9-14,16H2,1H3,(H,22,26) |
| InChIKey | BBFILYLDGBAHKF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|