C17H28N4O5S2 — CID 55429208
N-(3-methoxypropyl)-2-[4-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]piperazin-1-yl]acetamide (PubChem CID 55429208) has the molecular formula C17H28N4O5S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55429208 |
| Molecular Formula | C17H28N4O5S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[2-[methyl(thiophen-2-ylsulfonyl)amino]acetyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)CN(C)S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H28N4O5S2/c1-19(28(24,25)17-5-3-12-27-17)14-16(23)21-9-7-20(8-10-21)13-15(22)18-6-4-11-26-2/h3,5,12H,4,6-11,13-14H2,1-2H3,(H,18,22) |
| InChIKey | FJJWGKXVZYPKLV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|