C23H36N4O5S — CID 55427135
N-(3-methoxypropyl)-2-[4-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]piperazin-1-yl]acetamide (PubChem CID 55427135) has the molecular formula C23H36N4O5S and a molecular weight of 480.63 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55427135 |
| Molecular Formula | C23H36N4O5S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)Cc2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H36N4O5S/c1-32-17-5-10-24-22(28)19-25-13-15-26(16-14-25)23(29)18-20-6-8-21(9-7-20)33(30,31)27-11-3-2-4-12-27/h6-9H,2-5,10-19H2,1H3,(H,24,28) |
| InChIKey | IZRPVGBGZIOBOS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|