C17H25N3O5S — CID 119352613
4-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]butanoic acid (PubChem CID 119352613) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352613 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[[2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetyl]amino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)NCCCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O5S/c1-14-4-6-15(7-5-14)26(24,25)20-11-9-19(10-12-20)13-16(21)18-8-2-3-17(22)23/h4-7H,2-3,8-13H2,1H3,(H,18,21)(H,22,23) |
| InChIKey | QGLNHPDWWSUOPT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|