C13H19N3O3S — CID 8742873
2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 8742873) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8742873 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(N)=O)CC2)cc1 |
| InChI | InChI=1S/C13H19N3O3S/c1-11-2-4-12(5-3-11)20(18,19)16-8-6-15(7-9-16)10-13(14)17/h2-5H,6-10H2,1H3,(H2,14,17) |
| InChIKey | LGFMHSUBWNDDKJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |