C16H28Cl2N4O3S — CID 119501378
N-[2-(methylamino)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide;dihydrochloride (PubChem CID 119501378) has the molecular formula C16H28Cl2N4O3S and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119501378 |
| Molecular Formula | C16H28Cl2N4O3S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]acetamide;dihydrochloride |
| SMILES | CNCCNC(=O)CN1CCN(S(=O)(=O)c2ccc(C)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H26N4O3S.2ClH/c1-14-3-5-15(6-4-14)24(22,23)20-11-9-19(10-12-20)13-16(21)18-8-7-17-2;;/h3-6,17H,7-13H2,1-2H3,(H,18,21);2*1H |
| InChIKey | XQFGSJBUEZKFCA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|