C20H31N3O5S — CID 8819134
ethyl 4-[4-[2-oxo-2-(pentylamino)ethyl]piperazin-1-yl]sulfonylbenzoate (PubChem CID 8819134) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is ethyl 4-[4-[2-oxo-2-(pentylamino)ethyl]piperazin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[2-oxo-2-(pentylamino)ethyl]piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 8819134 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ethyl 4-[4-[2-oxo-2-(pentylamino)ethyl]piperazin-1-yl]sulfonylbenzoate |
| SMILES | CCCCCNC(=O)CN1CCN(S(=O)(=O)c2ccc(C(=O)OCC)cc2)CC1 |
| InChI | InChI=1S/C20H31N3O5S/c1-3-5-6-11-21-19(24)16-22-12-14-23(15-13-22)29(26,27)18-9-7-17(8-10-18)20(25)28-4-2/h7-10H,3-6,11-16H2,1-2H3,(H,21,24) |
| InChIKey | OAJKMRZREMRPQF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|