C22H32N4O6S — CID 2998224
ethyl 4-[4-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate (PubChem CID 2998224) has the molecular formula C22H32N4O6S and a molecular weight of 480.59 g/mol. Its IUPAC name is ethyl 4-[4-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 2998224 |
| Molecular Formula | C22H32N4O6S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | ethyl 4-[4-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(CC(=O)NC(=O)NC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H32N4O6S/c1-2-32-21(28)17-8-10-19(11-9-17)33(30,31)26-14-12-25(13-15-26)16-20(27)24-22(29)23-18-6-4-3-5-7-18/h8-11,18H,2-7,12-16H2,1H3,(H2,23,24,27,29) |
| InChIKey | XIUPRORGTIZASM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |