C19H35N5O4S — CID 16599138
2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(cyclohexylcarbamoyl)acetamide (PubChem CID 16599138) has the molecular formula C19H35N5O4S and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(cyclohexylcarbamoyl)acetamide.
| Compound Name | 2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(cyclohexylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 16599138 |
| Molecular Formula | C19H35N5O4S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-N-(cyclohexylcarbamoyl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)N2CCCCCC2)CC1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H35N5O4S/c25-18(21-19(26)20-17-8-4-3-5-9-17)16-22-12-14-24(15-13-22)29(27,28)23-10-6-1-2-7-11-23/h17H,1-16H2,(H2,20,21,25,26) |
| InChIKey | NGZOCDVMLZETCV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |