C21H36N4O3 — CID 86860953
N-[1-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide (PubChem CID 86860953) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[1-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 86860953 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N-[1-[2-(cyclohexylcarbamoylamino)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide |
| SMILES | O=C(CN1CCC(NC(=O)C2CCCCC2)CC1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H36N4O3/c26-19(24-21(28)23-17-9-5-2-6-10-17)15-25-13-11-18(12-14-25)22-20(27)16-7-3-1-4-8-16/h16-18H,1-15H2,(H,22,27)(H2,23,24,26,28) |
| InChIKey | WLBWKPHOVMRKNF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |