C17H30N4O4 — CID 34196633
tert-butyl 4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 34196633) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is tert-butyl 4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 34196633 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | tert-butyl 4-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C17H30N4O4/c1-17(2,3)25-16(24)21-10-8-20(9-11-21)12-14(22)19-15(23)18-13-6-4-5-7-13/h13H,4-12H2,1-3H3,(H2,18,19,22,23) |
| InChIKey | RNFLNSAWIZSMCI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |