C16H28N4O4 — CID 31692902
ethyl 4-[3-(cyclopentylcarbamoylamino)-3-oxopropyl]piperazine-1-carboxylate (PubChem CID 31692902) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethyl 4-[3-(cyclopentylcarbamoylamino)-3-oxopropyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(cyclopentylcarbamoylamino)-3-oxopropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 31692902 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | ethyl 4-[3-(cyclopentylcarbamoylamino)-3-oxopropyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCC(=O)NC(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C16H28N4O4/c1-2-24-16(23)20-11-9-19(10-12-20)8-7-14(21)18-15(22)17-13-5-3-4-6-13/h13H,2-12H2,1H3,(H2,17,18,21,22) |
| InChIKey | IBGGKXXUHJEUOX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |