C19H35N3O3 — CID 55591816
tert-butyl 4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 55591816) has the molecular formula C19H35N3O3 and a molecular weight of 353.51 g/mol. Its IUPAC name is tert-butyl 4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55591816 |
| Molecular Formula | C19H35N3O3 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | tert-butyl 4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCN(C(=O)CN1CCN(C(=O)OC(C)(C)C)CC1)C1CCCCC1 |
| InChI | InChI=1S/C19H35N3O3/c1-5-22(16-9-7-6-8-10-16)17(23)15-20-11-13-21(14-12-20)18(24)25-19(2,3)4/h16H,5-15H2,1-4H3 |
| InChIKey | SVDDOMPEKFSUJS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |