C18H36N4O4S — CID 55737815
tert-butyl 4-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]piperazine-1-carboxylate (PubChem CID 55737815) has the molecular formula C18H36N4O4S and a molecular weight of 404.58 g/mol. Its IUPAC name is tert-butyl 4-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55737815 |
| Molecular Formula | C18H36N4O4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | tert-butyl 4-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]piperazine-1-carboxylate |
| SMILES | CN(C1CCCCC1)S(=O)(=O)NCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H36N4O4S/c1-18(2,3)26-17(23)22-14-12-21(13-15-22)11-10-19-27(24,25)20(4)16-8-6-5-7-9-16/h16,19H,5-15H2,1-4H3 |
| InChIKey | ZVMJIDPOLGOPLM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |