C21H32N4O5S — CID 55353755
2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide (PubChem CID 55353755) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 55353755 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CC(=O)NC(=O)NC3CCCCC3C)CC2)cc1 |
| InChI | InChI=1S/C21H32N4O5S/c1-16-5-3-4-6-19(16)22-21(27)23-20(26)15-24-11-13-25(14-12-24)31(28,29)18-9-7-17(30-2)8-10-18/h7-10,16,19H,3-6,11-15H2,1-2H3,(H2,22,23,26,27) |
| InChIKey | UUFYHZNTDQTGIB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |