C20H29ClN4O4S — CID 55354596
2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide (PubChem CID 55354596) has the molecular formula C20H29ClN4O4S and a molecular weight of 457.00 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 55354596 |
| Molecular Formula | C20H29ClN4O4S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
| SMILES | CC1CCCCC1NC(=O)NC(=O)CN1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H29ClN4O4S/c1-15-5-2-3-8-18(15)22-20(27)23-19(26)14-24-9-11-25(12-10-24)30(28,29)17-7-4-6-16(21)13-17/h4,6-7,13,15,18H,2-3,5,8-12,14H2,1H3,(H2,22,23,26,27) |
| InChIKey | VRHAUWLUDDAIBK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |