C19H29N3O3S2 — CID 8745015
4-(4-methoxyphenyl)sulfonyl-N-[(1R,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide (PubChem CID 8745015) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-N-[(1R,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-N-[(1R,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8745015 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-N-[(1R,2R)-2-methylcyclohexyl]piperazine-1-carbothioamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=S)N[C@@H]3CCCC[C@H]3C)CC2)cc1 |
| InChI | InChI=1S/C19H29N3O3S2/c1-15-5-3-4-6-18(15)20-19(26)21-11-13-22(14-12-21)27(23,24)17-9-7-16(25-2)8-10-17/h7-10,15,18H,3-6,11-14H2,1-2H3,(H,20,26)/t15-,18-/m1/s1 |
| InChIKey | YVOMMAQGSKVOKE-CRAIPNDOSA-N |
| XLogP | 2.45 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|