C19H29N3O3S2 — CID 8745095
N-cyclohexyl-4-(4-ethoxyphenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 8745095) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-cyclohexyl-4-(4-ethoxyphenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-(4-ethoxyphenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8745095 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-cyclohexyl-4-(4-ethoxyphenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=S)NC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H29N3O3S2/c1-2-25-17-8-10-18(11-9-17)27(23,24)22-14-12-21(13-15-22)19(26)20-16-6-4-3-5-7-16/h8-11,16H,2-7,12-15H2,1H3,(H,20,26) |
| InChIKey | GSZOAACAKCGNJC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|