C20H26N4O3S2 — CID 25238406
1-(4-ethoxyphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea (PubChem CID 25238406) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 25238406 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C20H26N4O3S2/c1-3-27-18-8-4-16(5-9-18)21-20(28)22-17-6-10-19(11-7-17)29(25,26)24-14-12-23(2)13-15-24/h4-11H,3,12-15H2,1-2H3,(H2,21,22,28) |
| InChIKey | HZFGVCWLLPEPDE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|